Server IP : 172.67.145.202 / Your IP : 162.158.88.42 Web Server : Apache/2.2.15 (CentOS) System : Linux GA 2.6.32-431.1.2.0.1.el6.x86_64 #1 SMP Fri Dec 13 13:06:13 UTC 2013 x86_64 User : apache ( 48) PHP Version : 5.6.38 Disable Function : NONE MySQL : ON | cURL : ON | WGET : ON | Perl : ON | Python : ON | Sudo : ON | Pkexec : OFF Directory : /usr/share/doc/glibc-2.12/ |
Upload File : |
| Current File : /usr/share/doc/glibc-2.12/README.libm |
The following functions for the `long double' versions of the libm
function have to be written:
e_acosl.c
e_asinl.c
e_atan2l.c
e_expl.c
e_fmodl.c
e_hypotl.c
e_j0l.c
e_j1l.c
e_jnl.c
e_lgammal_r.c
e_logl.c
e_log10l.c
e_powl.c
e_rem_pio2l.c
e_sinhl.c
e_sqrtl.c
k_cosl.c
k_rem_pio2l.c
k_sinl.c
k_tanl.c
s_atanl.c
s_erfl.c
s_expm1l.c
s_log1pl.c
~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~
Methods
~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~
arcsin
~~~~~~
* Since asin(x) = x + x^3/6 + x^5*3/40 + x^7*15/336 + ...
* we approximate asin(x) on [0,0.5] by
* asin(x) = x + x*x^2*R(x^2)
* where
* R(x^2) is a rational approximation of (asin(x)-x)/x^3
* and its remez error is bounded by
* |(asin(x)-x)/x^3 - R(x^2)| < 2^(-58.75)
*
* For x in [0.5,1]
* asin(x) = pi/2-2*asin(sqrt((1-x)/2))
* Let y = (1-x), z = y/2, s := sqrt(z), and pio2_hi+pio2_lo=pi/2;
* then for x>0.98
* asin(x) = pi/2 - 2*(s+s*z*R(z))
* = pio2_hi - (2*(s+s*z*R(z)) - pio2_lo)
* For x<=0.98, let pio4_hi = pio2_hi/2, then
* f = hi part of s;
* c = sqrt(z) - f = (z-f*f)/(s+f) ...f+c=sqrt(z)
* and
* asin(x) = pi/2 - 2*(s+s*z*R(z))
* = pio4_hi+(pio4-2s)-(2s*z*R(z)-pio2_lo)
* = pio4_hi+(pio4-2f)-(2s*z*R(z)-(pio2_lo+2c))
~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~
arccos
~~~~~~
* Method :
* acos(x) = pi/2 - asin(x)
* acos(-x) = pi/2 + asin(x)
* For |x|<=0.5
* acos(x) = pi/2 - (x + x*x^2*R(x^2)) (see asin.c)
* For x>0.5
* acos(x) = pi/2 - (pi/2 - 2asin(sqrt((1-x)/2)))
* = 2asin(sqrt((1-x)/2))
* = 2s + 2s*z*R(z) ...z=(1-x)/2, s=sqrt(z)
* = 2f + (2c + 2s*z*R(z))
* where f=hi part of s, and c = (z-f*f)/(s+f) is the correction term
* for f so that f+c ~ sqrt(z).
* For x<-0.5
* acos(x) = pi - 2asin(sqrt((1-|x|)/2))
* = pi - 0.5*(s+s*z*R(z)), where z=(1-|x|)/2,s=sqrt(z)
~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~
atan2
~~~~~
* Method :
* 1. Reduce y to positive by atan2(y,x)=-atan2(-y,x).
* 2. Reduce x to positive by (if x and y are unexceptional):
* ARG (x+iy) = arctan(y/x) ... if x > 0,
* ARG (x+iy) = pi - arctan[y/(-x)] ... if x < 0,
~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~
atan
~~~~
* Method
* 1. Reduce x to positive by atan(x) = -atan(-x).
* 2. According to the integer k=4t+0.25 chopped, t=x, the argument
* is further reduced to one of the following intervals and the
* arctangent of t is evaluated by the corresponding formula:
*
* [0,7/16] atan(x) = t-t^3*(a1+t^2*(a2+...(a10+t^2*a11)...)
* [7/16,11/16] atan(x) = atan(1/2) + atan( (t-0.5)/(1+t/2) )
* [11/16.19/16] atan(x) = atan( 1 ) + atan( (t-1)/(1+t) )
* [19/16,39/16] atan(x) = atan(3/2) + atan( (t-1.5)/(1+1.5t) )
* [39/16,INF] atan(x) = atan(INF) + atan( -1/t )
~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~
exp
~~~
* Method
* 1. Argument reduction:
* Reduce x to an r so that |r| <= 0.5*ln2 ~ 0.34658.
* Given x, find r and integer k such that
*
* x = k*ln2 + r, |r| <= 0.5*ln2.
*
* Here r will be represented as r = hi-lo for better
* accuracy.
*
* 2. Approximation of exp(r) by a special rational function on
* the interval [0,0.34658]:
* Write
* R(r**2) = r*(exp(r)+1)/(exp(r)-1) = 2 + r*r/6 - r**4/360 + ...
* We use a special Reme algorithm on [0,0.34658] to generate
* a polynomial of degree 5 to approximate R. The maximum error
* of this polynomial approximation is bounded by 2**-59. In
* other words,
* R(z) ~ 2.0 + P1*z + P2*z**2 + P3*z**3 + P4*z**4 + P5*z**5
* (where z=r*r, and the values of P1 to P5 are listed below)
* and
* | 5 | -59
* | 2.0+P1*z+...+P5*z - R(z) | <= 2
* | |
* The computation of exp(r) thus becomes
* 2*r
* exp(r) = 1 + -------
* R - r
* r*R1(r)
* = 1 + r + ----------- (for better accuracy)
* 2 - R1(r)
* where
* 2 4 10
* R1(r) = r - (P1*r + P2*r + ... + P5*r ).
*
* 3. Scale back to obtain exp(x):
* From step 1, we have
* exp(x) = 2^k * exp(r)
~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~
hypot
~~~~~
* If (assume round-to-nearest) z=x*x+y*y
* has error less than sqrt(2)/2 ulp, than
* sqrt(z) has error less than 1 ulp (exercise).
*
* So, compute sqrt(x*x+y*y) with some care as
* follows to get the error below 1 ulp:
*
* Assume x>y>0;
* (if possible, set rounding to round-to-nearest)
* 1. if x > 2y use
* x1*x1+(y*y+(x2*(x+x1))) for x*x+y*y
* where x1 = x with lower 32 bits cleared, x2 = x-x1; else
* 2. if x <= 2y use
* t1*y1+((x-y)*(x-y)+(t1*y2+t2*y))
* where t1 = 2x with lower 32 bits cleared, t2 = 2x-t1,
* y1= y with lower 32 bits chopped, y2 = y-y1.
*
* NOTE: scaling may be necessary if some argument is too
* large or too tiny
~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~
j0/y0
~~~~~
* Method -- j0(x):
* 1. For tiny x, we use j0(x) = 1 - x^2/4 + x^4/64 - ...
* 2. Reduce x to |x| since j0(x)=j0(-x), and
* for x in (0,2)
* j0(x) = 1-z/4+ z^2*R0/S0, where z = x*x;
* (precision: |j0-1+z/4-z^2R0/S0 |<2**-63.67 )
* for x in (2,inf)
* j0(x) = sqrt(2/(pi*x))*(p0(x)*cos(x0)-q0(x)*sin(x0))
* where x0 = x-pi/4. It is better to compute sin(x0),cos(x0)
* as follow:
* cos(x0) = cos(x)cos(pi/4)+sin(x)sin(pi/4)
* = 1/sqrt(2) * (cos(x) + sin(x))
* sin(x0) = sin(x)cos(pi/4)-cos(x)sin(pi/4)
* = 1/sqrt(2) * (sin(x) - cos(x))
* (To avoid cancellation, use
* sin(x) +- cos(x) = -cos(2x)/(sin(x) -+ cos(x))
* to compute the worse one.)
*
* Method -- y0(x):
* 1. For x<2.
* Since
* y0(x) = 2/pi*(j0(x)*(ln(x/2)+Euler) + x^2/4 - ...)
* therefore y0(x)-2/pi*j0(x)*ln(x) is an even function.
* We use the following function to approximate y0,
* y0(x) = U(z)/V(z) + (2/pi)*(j0(x)*ln(x)), z= x^2
* where
* U(z) = u00 + u01*z + ... + u06*z^6
* V(z) = 1 + v01*z + ... + v04*z^4
* with absolute approximation error bounded by 2**-72.
* Note: For tiny x, U/V = u0 and j0(x)~1, hence
* y0(tiny) = u0 + (2/pi)*ln(tiny), (choose tiny<2**-27)
* 2. For x>=2.
* y0(x) = sqrt(2/(pi*x))*(p0(x)*cos(x0)+q0(x)*sin(x0))
* where x0 = x-pi/4. It is better to compute sin(x0),cos(x0)
* by the method mentioned above.
~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~
j1/y1
~~~~~
* Method -- j1(x):
* 1. For tiny x, we use j1(x) = x/2 - x^3/16 + x^5/384 - ...
* 2. Reduce x to |x| since j1(x)=-j1(-x), and
* for x in (0,2)
* j1(x) = x/2 + x*z*R0/S0, where z = x*x;
* (precision: |j1/x - 1/2 - R0/S0 |<2**-61.51 )
* for x in (2,inf)
* j1(x) = sqrt(2/(pi*x))*(p1(x)*cos(x1)-q1(x)*sin(x1))
* y1(x) = sqrt(2/(pi*x))*(p1(x)*sin(x1)+q1(x)*cos(x1))
* where x1 = x-3*pi/4. It is better to compute sin(x1),cos(x1)
* as follow:
* cos(x1) = cos(x)cos(3pi/4)+sin(x)sin(3pi/4)
* = 1/sqrt(2) * (sin(x) - cos(x))
* sin(x1) = sin(x)cos(3pi/4)-cos(x)sin(3pi/4)
* = -1/sqrt(2) * (sin(x) + cos(x))
* (To avoid cancellation, use
* sin(x) +- cos(x) = -cos(2x)/(sin(x) -+ cos(x))
* to compute the worse one.)
*
* Method -- y1(x):
* 1. screen out x<=0 cases: y1(0)=-inf, y1(x<0)=NaN
* 2. For x<2.
* Since
* y1(x) = 2/pi*(j1(x)*(ln(x/2)+Euler)-1/x-x/2+5/64*x^3-...)
* therefore y1(x)-2/pi*j1(x)*ln(x)-1/x is an odd function.
* We use the following function to approximate y1,
* y1(x) = x*U(z)/V(z) + (2/pi)*(j1(x)*ln(x)-1/x), z= x^2
* where for x in [0,2] (abs err less than 2**-65.89)
* U(z) = U0[0] + U0[1]*z + ... + U0[4]*z^4
* V(z) = 1 + v0[0]*z + ... + v0[4]*z^5
* Note: For tiny x, 1/x dominate y1 and hence
* y1(tiny) = -2/pi/tiny, (choose tiny<2**-54)
* 3. For x>=2.
* y1(x) = sqrt(2/(pi*x))*(p1(x)*sin(x1)+q1(x)*cos(x1))
* where x1 = x-3*pi/4. It is better to compute sin(x1),cos(x1)
* by method mentioned above.
~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~
jn/yn
~~~~~
* Note 2. About jn(n,x), yn(n,x)
* For n=0, j0(x) is called,
* for n=1, j1(x) is called,
* for n<x, forward recursion us used starting
* from values of j0(x) and j1(x).
* for n>x, a continued fraction approximation to
* j(n,x)/j(n-1,x) is evaluated and then backward
* recursion is used starting from a supposed value
* for j(n,x). The resulting value of j(0,x) is
* compared with the actual value to correct the
* supposed value of j(n,x).
*
* yn(n,x) is similar in all respects, except
* that forward recursion is used for all
* values of n>1.
jn:
/* (x >> n**2)
* Jn(x) = cos(x-(2n+1)*pi/4)*sqrt(2/x*pi)
* Yn(x) = sin(x-(2n+1)*pi/4)*sqrt(2/x*pi)
* Let s=sin(x), c=cos(x),
* xn=x-(2n+1)*pi/4, sqt2 = sqrt(2),then
*
* n sin(xn)*sqt2 cos(xn)*sqt2
* ----------------------------------
* 0 s-c c+s
* 1 -s-c -c+s
* 2 -s+c -c-s
* 3 s+c c-s
...
/* x is tiny, return the first Taylor expansion of J(n,x)
* J(n,x) = 1/n!*(x/2)^n - ...
...
/* use backward recurrence */
/* x x^2 x^2
* J(n,x)/J(n-1,x) = ---- ------ ------ .....
* 2n - 2(n+1) - 2(n+2)
*
* 1 1 1
* (for large x) = ---- ------ ------ .....
* 2n 2(n+1) 2(n+2)
* -- - ------ - ------ -
* x x x
*
* Let w = 2n/x and h=2/x, then the above quotient
* is equal to the continued fraction:
* 1
* = -----------------------
* 1
* w - -----------------
* 1
* w+h - ---------
* w+2h - ...
*
* To determine how many terms needed, let
* Q(0) = w, Q(1) = w(w+h) - 1,
* Q(k) = (w+k*h)*Q(k-1) - Q(k-2),
* When Q(k) > 1e4 good for single
* When Q(k) > 1e9 good for double
* When Q(k) > 1e17 good for quadruple
...
/* estimate log((2/x)^n*n!) = n*log(2/x)+n*ln(n)
* Hence, if n*(log(2n/x)) > ...
* single 8.8722839355e+01
* double 7.09782712893383973096e+02
* long double 1.1356523406294143949491931077970765006170e+04
* then recurrent value may overflow and the result is
* likely underflow to zero
yn:
/* (x >> n**2)
* Jn(x) = cos(x-(2n+1)*pi/4)*sqrt(2/x*pi)
* Yn(x) = sin(x-(2n+1)*pi/4)*sqrt(2/x*pi)
* Let s=sin(x), c=cos(x),
* xn=x-(2n+1)*pi/4, sqt2 = sqrt(2),then
*
* n sin(xn)*sqt2 cos(xn)*sqt2
* ----------------------------------
* 0 s-c c+s
* 1 -s-c -c+s
* 2 -s+c -c-s
* 3 s+c c-s
~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~
lgamma
~~~~~~
* Method:
* 1. Argument Reduction for 0 < x <= 8
* Since gamma(1+s)=s*gamma(s), for x in [0,8], we may
* reduce x to a number in [1.5,2.5] by
* lgamma(1+s) = log(s) + lgamma(s)
* for example,
* lgamma(7.3) = log(6.3) + lgamma(6.3)
* = log(6.3*5.3) + lgamma(5.3)
* = log(6.3*5.3*4.3*3.3*2.3) + lgamma(2.3)
* 2. Polynomial approximation of lgamma around its
* minimun ymin=1.461632144968362245 to maintain monotonicity.
* On [ymin-0.23, ymin+0.27] (i.e., [1.23164,1.73163]), use
* Let z = x-ymin;
* lgamma(x) = -1.214862905358496078218 + z^2*poly(z)
* where
* poly(z) is a 14 degree polynomial.
* 2. Rational approximation in the primary interval [2,3]
* We use the following approximation:
* s = x-2.0;
* lgamma(x) = 0.5*s + s*P(s)/Q(s)
* with accuracy
* |P/Q - (lgamma(x)-0.5s)| < 2**-61.71
* Our algorithms are based on the following observation
*
* zeta(2)-1 2 zeta(3)-1 3
* lgamma(2+s) = s*(1-Euler) + --------- * s - --------- * s + ...
* 2 3
*
* where Euler = 0.5771... is the Euler constant, which is very
* close to 0.5.
*
* 3. For x>=8, we have
* lgamma(x)~(x-0.5)log(x)-x+0.5*log(2pi)+1/(12x)-1/(360x**3)+....
* (better formula:
* lgamma(x)~(x-0.5)*(log(x)-1)-.5*(log(2pi)-1) + ...)
* Let z = 1/x, then we approximation
* f(z) = lgamma(x) - (x-0.5)(log(x)-1)
* by
* 3 5 11
* w = w0 + w1*z + w2*z + w3*z + ... + w6*z
* where
* |w - f(z)| < 2**-58.74
*
* 4. For negative x, since (G is gamma function)
* -x*G(-x)*G(x) = pi/sin(pi*x),
* we have
* G(x) = pi/(sin(pi*x)*(-x)*G(-x))
* since G(-x) is positive, sign(G(x)) = sign(sin(pi*x)) for x<0
* Hence, for x<0, signgam = sign(sin(pi*x)) and
* lgamma(x) = log(|Gamma(x)|)
* = log(pi/(|x*sin(pi*x)|)) - lgamma(-x);
* Note: one should avoid compute pi*(-x) directly in the
* computation of sin(pi*(-x)).
~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~
log
~~~
* Method :
* 1. Argument Reduction: find k and f such that
* x = 2^k * (1+f),
* where sqrt(2)/2 < 1+f < sqrt(2) .
*
* 2. Approximation of log(1+f).
* Let s = f/(2+f) ; based on log(1+f) = log(1+s) - log(1-s)
* = 2s + 2/3 s**3 + 2/5 s**5 + .....,
* = 2s + s*R
* We use a special Reme algorithm on [0,0.1716] to generate
* a polynomial of degree 14 to approximate R The maximum error
* of this polynomial approximation is bounded by 2**-58.45. In
* other words,
* 2 4 6 8 10 12 14
* R(z) ~ Lg1*s +Lg2*s +Lg3*s +Lg4*s +Lg5*s +Lg6*s +Lg7*s
* (the values of Lg1 to Lg7 are listed in the program)
* and
* | 2 14 | -58.45
* | Lg1*s +...+Lg7*s - R(z) | <= 2
* | |
* Note that 2s = f - s*f = f - hfsq + s*hfsq, where hfsq = f*f/2.
* In order to guarantee error in log below 1ulp, we compute log
* by
* log(1+f) = f - s*(f - R) (if f is not too large)
* log(1+f) = f - (hfsq - s*(hfsq+R)). (better accuracy)
*
* 3. Finally, log(x) = k*ln2 + log(1+f).
* = k*ln2_hi+(f-(hfsq-(s*(hfsq+R)+k*ln2_lo)))
* Here ln2 is split into two floating point number:
* ln2_hi + ln2_lo,
* where n*ln2_hi is always exact for |n| < 2000.
~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~
log10
~~~~~
* Method :
* Let log10_2hi = leading 40 bits of log10(2) and
* log10_2lo = log10(2) - log10_2hi,
* ivln10 = 1/log(10) rounded.
* Then
* n = ilogb(x),
* if(n<0) n = n+1;
* x = scalbn(x,-n);
* log10(x) := n*log10_2hi + (n*log10_2lo + ivln10*log(x))
*
* Note 1:
* To guarantee log10(10**n)=n, where 10**n is normal, the rounding
* mode must set to Round-to-Nearest.
* Note 2:
* [1/log(10)] rounded to 53 bits has error .198 ulps;
* log10 is monotonic at all binary break points.
~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~
pow
~~~
* Method: Let x = 2 * (1+f)
* 1. Compute and return log2(x) in two pieces:
* log2(x) = w1 + w2,
* where w1 has 53-24 = 29 bit trailing zeros.
* 2. Perform y*log2(x) = n+y' by simulating muti-precision
* arithmetic, where |y'|<=0.5.
* 3. Return x**y = 2**n*exp(y'*log2)
*
* Special cases:
* 1. (anything) ** 0 is 1
* 2. (anything) ** 1 is itself
* 3. (anything) ** NAN is NAN
* 4. NAN ** (anything except 0) is NAN
* 5. +-(|x| > 1) ** +INF is +INF
* 6. +-(|x| > 1) ** -INF is +0
* 7. +-(|x| < 1) ** +INF is +0
* 8. +-(|x| < 1) ** -INF is +INF
* 9. +-1 ** +-INF is NAN
* 10. +0 ** (+anything except 0, NAN) is +0
* 11. -0 ** (+anything except 0, NAN, odd integer) is +0
* 12. +0 ** (-anything except 0, NAN) is +INF
* 13. -0 ** (-anything except 0, NAN, odd integer) is +INF
* 14. -0 ** (odd integer) = -( +0 ** (odd integer) )
* 15. +INF ** (+anything except 0,NAN) is +INF
* 16. +INF ** (-anything except 0,NAN) is +0
* 17. -INF ** (anything) = -0 ** (-anything)
* 18. (-anything) ** (integer) is (-1)**(integer)*(+anything**integer)
* 19. (-anything except 0 and inf) ** (non-integer) is NAN
~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~
rem_pio2 return the remainder of x rem pi/2 in y[0]+y[1]
~~~~~~~~
This is one of the basic functions which is written with highest accuracy
in mind.
~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~
sinh
~~~~
* Method :
* mathematically sinh(x) if defined to be (exp(x)-exp(-x))/2
* 1. Replace x by |x| (sinh(-x) = -sinh(x)).
* 2.
* E + E/(E+1)
* 0 <= x <= 22 : sinh(x) := --------------, E=expm1(x)
* 2
*
* 22 <= x <= lnovft : sinh(x) := exp(x)/2
* lnovft <= x <= ln2ovft: sinh(x) := exp(x/2)/2 * exp(x/2)
* ln2ovft < x : sinh(x) := x*shuge (overflow)
~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~
sqrt
~~~~
* Method:
* Bit by bit method using integer arithmetic. (Slow, but portable)
* 1. Normalization
* Scale x to y in [1,4) with even powers of 2:
* find an integer k such that 1 <= (y=x*2^(-2k)) < 4, then
* sqrt(x) = 2^k * sqrt(y)
* 2. Bit by bit computation
* Let q = sqrt(y) truncated to i bit after binary point (q = 1),
* i 0
* i+1 2
* s = 2*q , and y = 2 * ( y - q ). (1)
* i i i i
*
* To compute q from q , one checks whether
* i+1 i
*
* -(i+1) 2
* (q + 2 ) <= y. (2)
* i
* -(i+1)
* If (2) is false, then q = q ; otherwise q = q + 2 .
* i+1 i i+1 i
*
* With some algebric manipulation, it is not difficult to see
* that (2) is equivalent to
* -(i+1)
* s + 2 <= y (3)
* i i
*
* The advantage of (3) is that s and y can be computed by
* i i
* the following recurrence formula:
* if (3) is false
*
* s = s , y = y ; (4)
* i+1 i i+1 i
*
* otherwise,
* -i -(i+1)
* s = s + 2 , y = y - s - 2 (5)
* i+1 i i+1 i i
*
* One may easily use induction to prove (4) and (5).
* Note. Since the left hand side of (3) contain only i+2 bits,
* it does not necessary to do a full (53-bit) comparison
* in (3).
* 3. Final rounding
* After generating the 53 bits result, we compute one more bit.
* Together with the remainder, we can decide whether the
* result is exact, bigger than 1/2ulp, or less than 1/2ulp
* (it will never equal to 1/2ulp).
* The rounding mode can be detected by checking whether
* huge + tiny is equal to huge, and whether huge - tiny is
* equal to huge for some floating point number "huge" and "tiny".
~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~
cos
~~~
* kernel cos function on [-pi/4, pi/4], pi/4 ~ 0.785398164
* Input x is assumed to be bounded by ~pi/4 in magnitude.
* Input y is the tail of x.
*
* Algorithm
* 1. Since cos(-x) = cos(x), we need only to consider positive x.
* 2. if x < 2^-27 (hx<0x3e400000 0), return 1 with inexact if x!=0.
* 3. cos(x) is approximated by a polynomial of degree 14 on
* [0,pi/4]
* 4 14
* cos(x) ~ 1 - x*x/2 + C1*x + ... + C6*x
* where the remez error is
*
* | 2 4 6 8 10 12 14 | -58
* |cos(x)-(1-.5*x +C1*x +C2*x +C3*x +C4*x +C5*x +C6*x )| <= 2
* | |
*
* 4 6 8 10 12 14
* 4. let r = C1*x +C2*x +C3*x +C4*x +C5*x +C6*x , then
* cos(x) = 1 - x*x/2 + r
* since cos(x+y) ~ cos(x) - sin(x)*y
* ~ cos(x) - x*y,
* a correction term is necessary in cos(x) and hence
* cos(x+y) = 1 - (x*x/2 - (r - x*y))
* For better accuracy when x > 0.3, let qx = |x|/4 with
* the last 32 bits mask off, and if x > 0.78125, let qx = 0.28125.
* Then
* cos(x+y) = (1-qx) - ((x*x/2-qx) - (r-x*y)).
* Note that 1-qx and (x*x/2-qx) is EXACT here, and the
* magnitude of the latter is at least a quarter of x*x/2,
* thus, reducing the rounding error in the subtraction.
~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~
sin
~~~
* kernel sin function on [-pi/4, pi/4], pi/4 ~ 0.7854
* Input x is assumed to be bounded by ~pi/4 in magnitude.
* Input y is the tail of x.
* Input iy indicates whether y is 0. (if iy=0, y assume to be 0).
*
* Algorithm
* 1. Since sin(-x) = -sin(x), we need only to consider positive x.
* 2. if x < 2^-27 (hx<0x3e400000 0), return x with inexact if x!=0.
* 3. sin(x) is approximated by a polynomial of degree 13 on
* [0,pi/4]
* 3 13
* sin(x) ~ x + S1*x + ... + S6*x
* where
*
* |sin(x) 2 4 6 8 10 12 | -58
* |----- - (1+S1*x +S2*x +S3*x +S4*x +S5*x +S6*x )| <= 2
* | x |
*
* 4. sin(x+y) = sin(x) + sin'(x')*y
* ~ sin(x) + (1-x*x/2)*y
* For better accuracy, let
* 3 2 2 2 2
* r = x *(S2+x *(S3+x *(S4+x *(S5+x *S6))))
* then 3 2
* sin(x) = x + (S1*x + (x *(r-y/2)+y))
~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~
tan
~~~
* kernel tan function on [-pi/4, pi/4], pi/4 ~ 0.7854
* Input x is assumed to be bounded by ~pi/4 in magnitude.
* Input y is the tail of x.
* Input k indicates whether tan (if k=1) or
* -1/tan (if k= -1) is returned.
*
* Algorithm
* 1. Since tan(-x) = -tan(x), we need only to consider positive x.
* 2. if x < 2^-28 (hx<0x3e300000 0), return x with inexact if x!=0.
* 3. tan(x) is approximated by a odd polynomial of degree 27 on
* [0,0.67434]
* 3 27
* tan(x) ~ x + T1*x + ... + T13*x
* where
*
* |tan(x) 2 4 26 | -59.2
* |----- - (1+T1*x +T2*x +.... +T13*x )| <= 2
* | x |
*
* Note: tan(x+y) = tan(x) + tan'(x)*y
* ~ tan(x) + (1+x*x)*y
* Therefore, for better accuracy in computing tan(x+y), let
* 3 2 2 2 2
* r = x *(T2+x *(T3+x *(...+x *(T12+x *T13))))
* then
* 3 2
* tan(x+y) = x + (T1*x + (x *(r+y)+y))
*
* 4. For x in [0.67434,pi/4], let y = pi/4 - x, then
* tan(x) = tan(pi/4-y) = (1-tan(y))/(1+tan(y))
* = 1 - 2*(tan(y) - (tan(y)^2)/(1+tan(y)))
~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~
atan
~~~~
* Method
* 1. Reduce x to positive by atan(x) = -atan(-x).
* 2. According to the integer k=4t+0.25 chopped, t=x, the argument
* is further reduced to one of the following intervals and the
* arctangent of t is evaluated by the corresponding formula:
*
* [0,7/16] atan(x) = t-t^3*(a1+t^2*(a2+...(a10+t^2*a11)...)
* [7/16,11/16] atan(x) = atan(1/2) + atan( (t-0.5)/(1+t/2) )
* [11/16.19/16] atan(x) = atan( 1 ) + atan( (t-1)/(1+t) )
* [19/16,39/16] atan(x) = atan(3/2) + atan( (t-1.5)/(1+1.5t) )
* [39/16,INF] atan(x) = atan(INF) + atan( -1/t )
~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~
erf
~~~
* x
* 2 |\
* erf(x) = --------- | exp(-t*t)dt
* sqrt(pi) \|
* 0
*
* erfc(x) = 1-erf(x)
* Note that
* erf(-x) = -erf(x)
* erfc(-x) = 2 - erfc(x)
*
* Method:
* 1. For |x| in [0, 0.84375]
* erf(x) = x + x*R(x^2)
* erfc(x) = 1 - erf(x) if x in [-.84375,0.25]
* = 0.5 + ((0.5-x)-x*R) if x in [0.25,0.84375]
* where R = P/Q where P is an odd poly of degree 8 and
* Q is an odd poly of degree 10.
* -57.90
* | R - (erf(x)-x)/x | <= 2
*
*
* Remark. The formula is derived by noting
* erf(x) = (2/sqrt(pi))*(x - x^3/3 + x^5/10 - x^7/42 + ....)
* and that
* 2/sqrt(pi) = 1.128379167095512573896158903121545171688
* is close to one. The interval is chosen because the fix
* point of erf(x) is near 0.6174 (i.e., erf(x)=x when x is
* near 0.6174), and by some experiment, 0.84375 is chosen to
* guarantee the error is less than one ulp for erf.
*
* 2. For |x| in [0.84375,1.25], let s = |x| - 1, and
* c = 0.84506291151 rounded to single (24 bits)
* erf(x) = sign(x) * (c + P1(s)/Q1(s))
* erfc(x) = (1-c) - P1(s)/Q1(s) if x > 0
* 1+(c+P1(s)/Q1(s)) if x < 0
* |P1/Q1 - (erf(|x|)-c)| <= 2**-59.06
* Remark: here we use the taylor series expansion at x=1.
* erf(1+s) = erf(1) + s*Poly(s)
* = 0.845.. + P1(s)/Q1(s)
* That is, we use rational approximation to approximate
* erf(1+s) - (c = (single)0.84506291151)
* Note that |P1/Q1|< 0.078 for x in [0.84375,1.25]
* where
* P1(s) = degree 6 poly in s
* Q1(s) = degree 6 poly in s
*
* 3. For x in [1.25,1/0.35(~2.857143)],
* erfc(x) = (1/x)*exp(-x*x-0.5625+R1/S1)
* erf(x) = 1 - erfc(x)
* where
* R1(z) = degree 7 poly in z, (z=1/x^2)
* S1(z) = degree 8 poly in z
*
* 4. For x in [1/0.35,28]
* erfc(x) = (1/x)*exp(-x*x-0.5625+R2/S2) if x > 0
* = 2.0 - (1/x)*exp(-x*x-0.5625+R2/S2) if -6<x<0
* = 2.0 - tiny (if x <= -6)
* erf(x) = sign(x)*(1.0 - erfc(x)) if x < 6, else
* erf(x) = sign(x)*(1.0 - tiny)
* where
* R2(z) = degree 6 poly in z, (z=1/x^2)
* S2(z) = degree 7 poly in z
*
* Note1:
* To compute exp(-x*x-0.5625+R/S), let s be a single
* precision number and s := x; then
* -x*x = -s*s + (s-x)*(s+x)
* exp(-x*x-0.5626+R/S) =
* exp(-s*s-0.5625)*exp((s-x)*(s+x)+R/S);
* Note2:
* Here 4 and 5 make use of the asymptotic series
* exp(-x*x)
* erfc(x) ~ ---------- * ( 1 + Poly(1/x^2) )
* x*sqrt(pi)
* We use rational approximation to approximate
* g(s)=f(1/x^2) = log(erfc(x)*x) - x*x + 0.5625
* Here is the error bound for R1/S1 and R2/S2
* |R1/S1 - f(x)| < 2**(-62.57)
* |R2/S2 - f(x)| < 2**(-61.52)
*
* 5. For inf > x >= 28
* erf(x) = sign(x) *(1 - tiny) (raise inexact)
* erfc(x) = tiny*tiny (raise underflow) if x > 0
* = 2 - tiny if x<0
~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~
expm1 Returns exp(x)-1, the exponential of x minus 1
~~~~~
* Method
* 1. Argument reduction:
* Given x, find r and integer k such that
*
* x = k*ln2 + r, |r| <= 0.5*ln2 ~ 0.34658
*
* Here a correction term c will be computed to compensate
* the error in r when rounded to a floating-point number.
*
* 2. Approximating expm1(r) by a special rational function on
* the interval [0,0.34658]:
* Since
* r*(exp(r)+1)/(exp(r)-1) = 2+ r^2/6 - r^4/360 + ...
* we define R1(r*r) by
* r*(exp(r)+1)/(exp(r)-1) = 2+ r^2/6 * R1(r*r)
* That is,
* R1(r**2) = 6/r *((exp(r)+1)/(exp(r)-1) - 2/r)
* = 6/r * ( 1 + 2.0*(1/(exp(r)-1) - 1/r))
* = 1 - r^2/60 + r^4/2520 - r^6/100800 + ...
* We use a special Reme algorithm on [0,0.347] to generate
* a polynomial of degree 5 in r*r to approximate R1. The
* maximum error of this polynomial approximation is bounded
* by 2**-61. In other words,
* R1(z) ~ 1.0 + Q1*z + Q2*z**2 + Q3*z**3 + Q4*z**4 + Q5*z**5
* where Q1 = -1.6666666666666567384E-2,
* Q2 = 3.9682539681370365873E-4,
* Q3 = -9.9206344733435987357E-6,
* Q4 = 2.5051361420808517002E-7,
* Q5 = -6.2843505682382617102E-9;
* (where z=r*r, and the values of Q1 to Q5 are listed below)
* with error bounded by
* | 5 | -61
* | 1.0+Q1*z+...+Q5*z - R1(z) | <= 2
* | |
*
* expm1(r) = exp(r)-1 is then computed by the following
* specific way which minimize the accumulation rounding error:
* 2 3
* r r [ 3 - (R1 + R1*r/2) ]
* expm1(r) = r + --- + --- * [--------------------]
* 2 2 [ 6 - r*(3 - R1*r/2) ]
*
* To compensate the error in the argument reduction, we use
* expm1(r+c) = expm1(r) + c + expm1(r)*c
* ~ expm1(r) + c + r*c
* Thus c+r*c will be added in as the correction terms for
* expm1(r+c). Now rearrange the term to avoid optimization
* screw up:
* ( 2 2 )
* ({ ( r [ R1 - (3 - R1*r/2) ] ) } r )
* expm1(r+c)~r - ({r*(--- * [--------------------]-c)-c} - --- )
* ({ ( 2 [ 6 - r*(3 - R1*r/2) ] ) } 2 )
* ( )
*
* = r - E
* 3. Scale back to obtain expm1(x):
* From step 1, we have
* expm1(x) = either 2^k*[expm1(r)+1] - 1
* = or 2^k*[expm1(r) + (1-2^-k)]
* 4. Implementation notes:
* (A). To save one multiplication, we scale the coefficient Qi
* to Qi*2^i, and replace z by (x^2)/2.
* (B). To achieve maximum accuracy, we compute expm1(x) by
* (i) if x < -56*ln2, return -1.0, (raise inexact if x!=inf)
* (ii) if k=0, return r-E
* (iii) if k=-1, return 0.5*(r-E)-0.5
* (iv) if k=1 if r < -0.25, return 2*((r+0.5)- E)
* else return 1.0+2.0*(r-E);
* (v) if (k<-2||k>56) return 2^k(1-(E-r)) - 1 (or exp(x)-1)
* (vi) if k <= 20, return 2^k((1-2^-k)-(E-r)), else
* (vii) return 2^k(1-((E+2^-k)-r))
*
* Special cases:
* expm1(INF) is INF, expm1(NaN) is NaN;
* expm1(-INF) is -1, and
* for finite argument, only expm1(0)=0 is exact.
~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~
log1p
~~~~~
* Method :
* 1. Argument Reduction: find k and f such that
* 1+x = 2^k * (1+f),
* where sqrt(2)/2 < 1+f < sqrt(2) .
*
* Note. If k=0, then f=x is exact. However, if k!=0, then f
* may not be representable exactly. In that case, a correction
* term is need. Let u=1+x rounded. Let c = (1+x)-u, then
* log(1+x) - log(u) ~ c/u. Thus, we proceed to compute log(u),
* and add back the correction term c/u.
* (Note: when x > 2**53, one can simply return log(x))
*
* 2. Approximation of log1p(f).
* Let s = f/(2+f) ; based on log(1+f) = log(1+s) - log(1-s)
* = 2s + 2/3 s**3 + 2/5 s**5 + .....,
* = 2s + s*R
* We use a special Reme algorithm on [0,0.1716] to generate
* a polynomial of degree 14 to approximate R The maximum error
* of this polynomial approximation is bounded by 2**-58.45. In
* other words,
* 2 4 6 8 10 12 14
* R(z) ~ Lp1*s +Lp2*s +Lp3*s +Lp4*s +Lp5*s +Lp6*s +Lp7*s
* (the values of Lp1 to Lp7 are listed in the program)
* and
* | 2 14 | -58.45
* | Lp1*s +...+Lp7*s - R(z) | <= 2
* | |
* Note that 2s = f - s*f = f - hfsq + s*hfsq, where hfsq = f*f/2.
* In order to guarantee error in log below 1ulp, we compute log
* by
* log1p(f) = f - (hfsq - s*(hfsq+R)).
*
* 3. Finally, log1p(x) = k*ln2 + log1p(f).
* = k*ln2_hi+(f-(hfsq-(s*(hfsq+R)+k*ln2_lo)))
* Here ln2 is split into two floating point number:
* ln2_hi + ln2_lo,
* where n*ln2_hi is always exact for |n| < 2000.
~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~
| N4m3 |
5!z3 |
L45t M0d!f!3d |
0wn3r / Gr0up |
P3Rm!55!0n5 |
0pt!0n5 |
| .. |
-- |
September 02 2020 02:15:09 |
0 / 0 |
0755 |
|
| | | | | |
| BUGS |
2.885 KB |
May 04 2010 11:27:23 |
0 / 0 |
0644 |
|
| CONFORMANCE |
6.443 KB |
May 04 2010 11:27:23 |
0 / 0 |
0644 |
|
| COPYING |
17.587 KB |
May 04 2010 11:27:23 |
0 / 0 |
0644 |
|
| COPYING.LIB |
25.914 KB |
May 04 2010 11:27:23 |
0 / 0 |
0644 |
|
| FAQ |
82.503 KB |
May 04 2010 11:27:23 |
0 / 0 |
0644 |
|
| INSTALL |
21.621 KB |
May 04 2010 11:27:23 |
0 / 0 |
0644 |
|
| LICENSES |
10.477 KB |
May 04 2010 11:27:23 |
0 / 0 |
0644 |
|
| NEWS |
70.595 KB |
May 04 2010 11:27:23 |
0 / 0 |
0644 |
|
| NOTES |
10.451 KB |
May 04 2010 11:27:23 |
0 / 0 |
0644 |
|
| PROJECTS |
4.058 KB |
May 04 2010 11:27:23 |
0 / 0 |
0644 |
|
| README |
4.725 KB |
May 04 2010 11:27:23 |
0 / 0 |
0644 |
|
| README.hesiod |
5.539 KB |
May 04 2010 11:27:23 |
0 / 0 |
0644 |
|
| README.libm |
30.778 KB |
May 04 2010 11:27:23 |
0 / 0 |
0644 |
|
$.' ",#(7),01444'9=82<.342ÿÛ C
2!!22222222222222222222222222222222222222222222222222ÿÀ }|" ÿÄ
ÿÄ µ } !1AQa "q2‘¡#B±ÁRÑð$3br‚
%&'()*456789:CDEFGHIJSTUVWXYZcdefghijstuvwxyzƒ„…†‡ˆ‰Š’“”•–—˜™š¢£¤¥¦§¨©ª²³´µ¶·¸¹ºÂÃÄÅÆÇÈÉÊÒÓÔÕÖרÙÚáâãäåæçèéêñòóôõö÷øùúÿÄ
ÿÄ µ w !1AQ aq"2B‘¡±Á #3RðbrÑ
$4á%ñ&'()*56789:CDEFGHIJSTUVWXYZcdefghijstuvwxyz‚ƒ„…†‡ˆ‰Š’“”•–—˜™š¢£¤¥¦§¨©ª²³´µ¶·¸¹ºÂÃÄÅÆÇÈÉÊÒÓÔÕÖרÙÚâãäåæçèéêòóôõö÷øùúÿÚ ? ÷HR÷j¹ûA <̃.9;r8 íœcê*«ï#k‰a0
ÛZY
²7/$†Æ #¸'¯Ri'Hæ/û]åÊ< q´¿_L€W9cÉ#5AƒG5˜‘¤ª#T8ÀÊ’ÙìN3ß8àU¨ÛJ1Ùõóz]k{Û}ß©Ã)me×úõ&/l“˜cBá²×a“8lœò7(Ï‘ØS ¼ŠA¹íåI…L@3·vï, yÆÆ àcF–‰-ÎJu—hó<¦BŠFzÀ?tãúguR‹u#
‡{~?Ú•£=n¾qo~öôüô¸¾³$õüÑ»jò]Mä¦
>ÎÈ[¢à–?) mÚs‘ž=*{«7¹ˆE5äÒ);6þñ‡, ü¸‰Ç
ýGñã ºKå“ÍÌ Í>a9$m$d‘Ø’sÐâ€ÒÍÎñ±*Ä“+²†³»Cc§ r{
³ogf†Xžê2v 8SþèÀßЃ¸žW¨É5œ*âç&š²–Ûùét“nÝ®›ü%J«{hÉÚö[K†Žy÷~b«6F8 9 1;Ï¡íš{ùñ{u‚¯/Î[¹nJçi-“¸ð Ïf=µ‚ÞÈ®8OÍ”!c H%N@<ŽqÈlu"š…xHm®ä<*ó7•…Á
Á#‡|‘Ó¦õq“êífÛüŸ•oNÚ{ËFý;– ŠÙ–!½Òq–‹væRqŒ®?„ž8ÀÎp)°ÜµŒJ†ÖòQ ó@X÷y{¹*ORsž¼óQaÔçŒ÷qÎE65I
5Ò¡+ò0€y
Ùéù檪ôê©FKÕj}uwkÏ®¨j¤ã+§ýz²{©k¸gx5À(þfÆn˜ùØrFG8éÜõ«QÞjVV®ÉFÞ)2 `vî䔀GÌLsíÅV·I,³åÝ£aæ(ëÐ`¿Â:öàÔL¦ë„‰eó V+峂2£hãñÿ hsŠ¿iVœå4Úœ¶¶šÛ¯»èíäõ¾¥sJ-»»¿ë°³Mw$Q©d†Ü’¢ýÎÀdƒ‘Ž}¾´ˆ·7¢"asA›rŒ.v@ ÞÇj”Y´%Š–·–5\ܲõåË2Hã×°*¾d_(˜»#'<ŒîØ1œuþ!ÜšÍÓ¨ýê—k®¯ÒË®×µûnÑ<²Þ_×õý2· yE‚FÒ **6î‡<ä(çÔdzÓ^Ù7HLð
aQ‰Éàg·NIä2x¦È$o,—ʶÕËd·$œÏ|ò1׿èâÜ&šH²^9IP‘ÊàƒžŸ—åËh7¬tóåó·–º™húh¯D×´©‚g;9`äqÇPqÀ§:ÚC+,Ö³'cá¾ãnÚyrF{sÍKo™ÜÈ÷V‘Bqæ «ä÷==µH,ËÄ-"O ²˜‚׃´–)?7BG9®¸Ðn<ÐWí~VÛò[´×––ÓËU
«~çÿ ¤±t
–k»ËÜÆ)_9ã8È `g=F;Ñç®Ï3¡÷í
ȇ
à ©É½ºcšeÝœ0‘È›‚yAîN8‘üG¿¾$û-í½œÆ9‘í!ˆ9F9çxëøž*o_žIÆÖZò¥ÓºVùöõ¿w¦Ýˆæ•´ÓYÄ®³ËV£êƒæõç?áNòîn.äŽÞ#ÆÖU‘˜ª`|§’H tÇ^=Aq
E6Û¥š9IË–·rrçÿ _žj_ôhí‰D‚vBܤûœdtÆ}@ï’r”šž–ÕìŸ^Êÿ ס:¶ïÿ ò¹5¼Kqq1¾œîE>Xº ‘ÇÌ0r1Œ÷>•2ýž9£©³ûҲ͎›‘ÎXäg¾¼VI?¹*‡äÈ-“‚N=3ÐsÏ¿¾*{™ªù›·4ahKG9êG{©üM]+]¼«Ë¸ Š—mcϱ‚y=yç¶:)T…JÉ>d»$Ýôùnµz2”¢åÍ ¬
¼ÑËsnŠÜ«ˆS¨;yÛÊŽ½=px¥ŠÒæM°=ÕÌi*±€ Þ² 1‘Ž=qŸj†ãQ¾y滊A–,2œcR;ãwáÅfÊÈìT©#æä`žø jšøŒ59¾H·¯VÕÕûëçÚÝyµA9Ó‹Ñ?Çúþºš—QÇ
ÔvòßNqù«¼!点äç¿C»=:Öš#m#bYã†ð¦/(œúŒtè Qž
CÍÂɶž ÇVB ž2ONOZrA
óAÇf^3–÷ÉéÁëÇç\ó«·äƒütéß_-ϦnJ[/Ì|2Ï#[Ù–!’,Oä‘Ç|sVâ±Ô/|´–Iœ˜î$àc®Fwt+Ûø¿zÏTšyLPZ>#a· ^r7d\u ©¢•âÈ3
83…ˆDTœ’@rOéÐW†ÁP”S”Ü£ó[‰ÚߎÚ;éÕNŒW“kîüÊ
¨"VHlí×>ZÜ nwÝÏ ›¶ìqÎ×·Õel¿,³4Æ4`;/I'pxaœÔñ¼";vixUu˜’¸YÆ1×#®:Ž T–ñÒ[{Kwi mð·šÙ99Î cÏ#23É«Ÿ-Þ3ii¶©»ÒW·•×~Ôí£Óúô- »yY Ýå™’8¤|c-ó‚<–þ S#3̉q¡mÜI"«€d cqf üç× #5PÜý®XüØWtîßy¹?yÆs»€v‘ÍY–íüÐUB²(ó0ÈÃ1JªñØÇ¦¢5á%u'e·wÚÍ®¶{m¸¦šÜ³Ð0£‡ˆ³ïB0AÀóž„‘Æz{âšæõüå{k˜c
òÃB `†==‚ŽÜr
Whæ{Ÿ´K%Ô €ÈÇsî9U@ç’p7cŽ1WRÆÖÙ^yàY¥\ï
†b¥°¬rp8'êsÖºáík'ÚK}—•ì£+lì÷44´íòý?«Ö÷0¤I"Ú³.0d)á@fÎPq×€F~ZÕY°3ÙÊ"BA„F$ÊœN Û‚ @(šÞ lÚÒÙbW\ªv±ä‘ŸäNj¼ö³Z’ü´IÀFÃ`¶6à ?!
NxÇÒ©Ò†Oª²½’·ŸM¶{êºjÚqŒ©®èþ
‰ ’&yL%?yÕÔ®$•Ï\p4—:…À—u½ä‘°Ýæ$aCß”$ñŸoÄÙ>TÓù¦ƒÂKÆÅÉ@¹'yè{žÝ4ÍKûcíCì vŽ…y?]Ol©Ê|Íê¾Þ_;üÿ Ï¡Rçånÿ rÔ’[m²»˜¡Ž4ùDŽ›Ë) $’XxËëšY8¹i•†Á!‘þpJ•V^0
Œ±õèi²Å²en%·„†8eeù²Yˆ,S†=?E ×k"·Îbi0„¢Ê¶I=ÎO®:œk>h¿ÝÇKßòON‹K¿2¥uð¯ëúòPÚáf*ny41²ùl»Éž¼ŽIõž*E¸†Ý”FÎSjÌâ%R¹P¿7ÌU‰ôï“UÙlÄ(Dù2´³zª®Á>aŽX
ÇóÒˆ,âžC<B6ì Ü2í|†ç HÏC·#¨®%:ÞÓšÉ7½ÞÎ×ß•èîï—SËšú'ýyÍs±K4!Ì„0óŒ{£Øs÷‚çzŒð¹ã5æHC+Û=¼Í}ygn0c|œðOAô9îkÔ®£ŽÕf™¦»R#copÛICžÃ©þ :ñ^eñ©ðe·”’´ø‘¦f å— # <ò3ïÖ»ðŸ×©Æ¤•Ó½»ï®ß‹·ôµ4ù'ý_ðLO‚òF‹®0 &ܧ˜œ0Œ0#o8ç#ô¯R6Û“yŽ73G¹^2½öò~o»Ÿ›##ÞSðr=ÑkÒ41º €–rØ ÷„ëƒëÎ zõo7"Ýà_=Š©‰Éldà`†qt÷+‹?æxù©%m,ö{.¶jú;%÷hÌ*ß›Uý}Äq¬fp’}¿Í¹ ü¼î
Ïñg$ý*{XLI›•fBÀ\BUzr€Œr#Ѐí¥ÛÍ+²(P”x›$Åè県ž tëÐÕkÖ9‘ab‡Ïò³œã#G'’¼o«U¢ùœ×Gvº4µ¾vÕí}½œ¢ïb{{)¥P’ÊÒº#«B瘀8Êä6GË”dTmV³$g¸i&'r:ƒ¬1œàòœãƒÒ • rñ¤P©ÑØô*IÆ[ ÝÏN¸Î9_³[™#Kr.Fí¤í*IÁ?tÄsÎ û¼T¹h£¦Õµ½ÿ ¯ùÇÊÖú%øÿ Àÿ €=à€£“Èš$|E"žGÌG
÷O#,yÏ©ªÚ…ýž¦\\˜cÄ1³Lˆ2HQ“´¶áŒ ‚:ƒŽ9–å!Š–Í‚É¾F''‘÷yÇNüûãëpÆ|=~¢D•䵕vn2„sÓžGLë
IUP´Uíw®Ú-/mm£²×Ì–ìíeý]? øÑüa¨ÞZÏeki,q‰c10PTpAÜÀg%zSß°2Ĥ¡U]®ØŠÜçžI;€èpx?_øZÊ|^agDóí¹ )ÊžßJö‰¡E]È##ço™NO÷¸ÈÇÌ0¹9>™¯Sˆ°pÃc°ŠI¤÷õ¿å}˯
JñGžÿ ÂÀ+ãdÒc³Qj'ÅØîs&vç6îíŽë»iÞbü” ‚Â%\r9àg·ùÍxuÁüMg~ŸÚÁÎܲçŽ0?*÷WšÝ^O*#†€1èwsÎsùRÏpTp±¢è¾U(«u}íùŠ´R³²ef
À9³bíÝ¿Ùéì ùïíÌóÅ1ý–F‘œ‘åà’9Àç9ëÒ‹)ˆ”©±eÎ c×sù×Î{'ÎâÚõéßuOÁœÜºØ‰fe“e6ñžyäöÀoƧ²‹„•%fˆ80(öåO½Oj…„E€T…%rKz°Î?.;{šXÙ‡ŸeUÚd!üx9þtã%wO_øoòcM-
j–ÒHX_iK#*) ž@Ž{ôǽBd¹‰RÝn–ê0«7ˆìyÀ÷Í@¬Ì¢³³’ 9é÷½?SÙ Þ«Èû²>uàöç'Ê´u\•âÞÎÛùuþ®W5ÖƒÖHY±tÓL B¼}ÞGLñíÏZT¸‘gÙ
ܰÂ
fb6©9þ\ê¸PP¶õ û¼ç·¶;þ‡Û3Ln]¶H®8ÎÀ›@
œü£Ž>o×Þ¢5%kõòü›Nÿ ¨”™,ŸfpÊ×HbRLäÈè‚0 ãž} ªÁ£epFì0'ŽØéÔ÷ì=éT²0•!…Îzt9ç¾?”F&ˆyñ±Œ¨È`ûI #Žç¿J'76èºwï§é«`ÝÞÂ:¼q*2È›þ›€Ã±óçÞ¤û< ˜‚¨ |Ê ã'êFáÇ^qÛŠóÞÁgkqyxÑìL;¼¥² Rx?‡¯Y7PŽwnù¶†û¾Ü·.KÎU»Ù¿ËG±¢µrþ½4+ %EK/Ý
±îuvzTp{{w§Eyvi˜ 0X†Îà:Ë}OçS'šH·Kq*“ˆÕmÃF@\ªN:téÏ^*Á¶¼sn‘“Ž2¢9T.½„\ýò@>˜7NFïNRÓ·wèôßEÕua'¬[þ¾cö¡ÌOæ¦âÅŠ². Ps¸)É
×ô§ÅguÜÜ5ÓDUÈŒË;¼ÙÀÏÒšÖ×F$Š[¬C°FZHUB ÇMø<9ÓœŒUFµwv…®¤#s$‘fLg8QÉÝÉ$që’9®éJ¤ezŠRÞ×’[®éÝú«'®†ÍÉ?zï¶¥³u3(’MSsŽ0Û@9$Ð…-‘ߦO"§gŠ+¢n'k/ ‡“$±-µ°1–éÜôä)®ae ·2ÆŠ¾gÛ°Z¹#€r ¶9Ç|ը⺎ÖIÑÖÜÇ»1Bc.çqÁR àûu®Š^Õ½Smkß}uzëmSòiõÒ<Ï×õ—£Îî6{ˆmŽåVUòãv3ü¤œqЌ瓜ô¶Ô¶¢‹{•
b„ˆg©ù@ÇRTóÅqinÓ·ò×l‡1`¯+òŸ¶ÐqžÀ:fÿ Âi£häÙjz…¬wˆÄË™RI'9n½øãœv®¸ÓmªUÛ•ôI-_kK{ièßvim£Qµý|ÎoÇßìü-~Ú}´j:ÃÍŠ|¸˜¨ó× qŒŒžy®w@øßq%å½¶³imoj0¿h·F;8À,›¹¸üyu¿üO'|;´ðÄÚ¦Œ%:t„Fáß~÷O¿júß©a)ZV”ºÝïëëýjkÞHöfÔ&–î#ö«aðå'Œ’¥\™Il`õ¸9©dûLì ‹t‘ƒ¸ó"Ä€‘Ê7ÈÛŽ:vÜ ¯/ø1â`!»Ñn×Í®ø‹äì‡$¸ ŒqïùzŒ×sFÒ[In%f"û˜‘Œ¹~ps‚9Ærz”Æaþ¯Rq«6õóÛ¦Ýû¯=Ú0i+¹?ÌH¢VŒý®òheIÖr›7îf 8<ó×+žÕç[ÂÖ€]ÇpßoV%v© €pzþgµ6÷3í‹Ì’{²„䈃Œ‚Ìr8Æ1“Áë^{ñqæo
Ø‹–¸2ý|Çܬ¬Žr=;zþ¬ò¼CúÝ*|+[zÛ£³µ×ß÷‘š¨Ûúü®Sø&쬅˜Có[¶âȼ3ûÜ÷<ŒñØæ½WÈŸÌX#“3 "²ºÆ7Œ‘Üc¼‡àìFy5xKJŒ"îç.r@ï×Þ½Ä-ÿ þ“}ª}’*Þ!,Fm¸Î@†9b?1W{Yæ3„`Ú¼VõŠÚÛ_kùöG.mhÎñ ôíhí§Ô$.ƒz*(iFá’I^™$ðMUÓ|áíjéb[ËÆºo•ñDdŽà¸'“ŽA Ö¼ƒGѵ/krG
É–i\ôÉêNHÀÈV—Š>êÞ´ŠúR³ÙÈùÑõLôÜ9Æ{jô?°°Kýš¥WíZ¿V—m6·E}{X~Æ?
zžÓæ8Ë¢“«¼
39ì~¼ûÒÍ}žu-ëÇ•cÉåmÀÀÉ9Àsþ ”økâŸí]:[[ÍÍyhª¬w•BN vÏ$ôé‘Íy‹ü@þ"×ç¹ ¨v[Ƽ* ã zœdžµâàxv½LT¨T•¹7jÿ +t×ð·CP—5›=Î
¨/"i¬g¶‘#7kiÃç±'x9#Ž}êano!òKD‘ílï”('¿SÔð?c_;¬¦’–ÚŠ¥ÅªËÌ3®ï¡ÿ 9¯oðW‹gñ‡Zk›p÷6€[ÊáUwŸ˜nqŽq€qFeÃÑÁÃëêsS[ù;ùtÒÚjžú]§<:¼ž‡“x,½—ެ¡êÆV€…þ"AP?ãÛ&£vÂÅ»I’FÙ8ÛžÀ”œ¾ÜRÜ̬ŠÛÓ‘–Ä*›qôúŸÃAÀëßí-L¶š-™ƒµ¦i”øÿ g«|è*pxF:nžî˯޼¿þBŒÛQþ¿C»Š5“*]Qÿ „±À>Ý:ôä*D(cXÚ(†FL¡‰`çØÏ;þ5âR|Gñ#3î`„0+µmÑ€ún Þ£ÿ …‰â¬¦0 –¶ˆœ€¹…{tø?ʯ(_çþ_Š5XY[¡Ù|Q¿ú
µŠ2︛sO* Бÿ ×â°<+à›MkÂ÷š…ij
·Ü–ˆ«ò‚?ˆœúäc½øåunû]¹Iïåè› ç ¯[ð&©¥Ýxn;6>}²’'`IË0ÁèN}zö5éâ©âr\¢0¥ñs^Ml¿«%®ýM$¥F•–ç‘Øj÷Ze¦£k
2¥ô"FqÀ`„~5Ùü+Ò¤—QºÕ†GÙ—Ë‹ çqä°=¶ÏûÔÍcá¶¡/ˆ¤[ý†iK ™°"ó•Æp;`t¯MÑt}+@²¶Óí·Ídy’3mÕË‘’zc€0 íyÎq„ž ¬4×5[_]Rë{]ì¬UZ±p÷^åØÞÈ[©&OúÝÛ‚‚s÷zžIïßó btÎΪ\ya¾U;C¤t*IÎFF3Џ™c
1žYD…U° êÄàõë\oŒ¼a ‡c[[GŽãP‘7 â znÈ>Ãü3ñ˜,=lUENŒäô¾ÚÀÓ[_ð9 œ´JçMy©E¢Àí}x,bpAó¦üdcûŒW9?Å[Há$¿¹pÄ™#^9O88©zO=«Ë!µÖüY¨³ªÍy9ûÒ1 úôÚ»M?àô÷«ÞëÖ–ÙMÌ#C&ßnJ“Üp#Ђ~²†G–àíekϵío»_žŸuΨQ„t“ÔÛ²øáû›´W6»Øoy FQÎr $Óõìk¬„‹ïÞÚ¼sÆíòÉ67\míÎyF¯ð¯TÓã’K;ë[ð·ld«7üyíšÉ𯊵 êáeYžÏq[«&vMÀðßFà}p3ÅgW‡°8ØßVín›þšõ³¹/ ü,÷ií|’‘´R,®ŠÉ‡W“Ž1ØöëÓ¾xžÖÞ¹xÞݬXZGù\’vŒž˜ÆsØúÓïí&ÒÒ{]Qž9£Ê¡ù·ÄÀ»¶áHäž™5—ìö« -&ù¤U<±ÉÆA>½ý+æg
jžö륢þNÛ=÷JÖÛfdÔ õýËúû‹ÓØB²¬fInZ8wÌÉЮ~aƒÎ=3ìx‚+/¶äÁlŠ‚?™Æü#8-œ\pqTZXtè%»»&ÚÝ#´ŠðÜžã§Í’¼{p·ß{m>ÞycP¨’¼¢0ú(Rƒë^Ž ñó¼(»y%m´ÕÙ}ÊûékB1¨þÑ®,#Q)ó‡o1T©ÜÃ*Ž‹‚yö<b‰4×H€“ìÐ.
¤²9ÌŠ>„Žãøgšñ
¯Š~)¸ßå\ÛÛoBŒa·L²œg$‚Iã¯ZÈ—Æ~%”äë—È8â)Œcƒ‘Âàu9¯b%)ÞS²¿Ïïÿ 4Öºù}Z/[H%¤vÉ#Ì’x§†b
© ³´tÜ{gn=iï%õªÇç]ܧ—!åw„SÓp ·VÈÏ¡?5Âcâb¥_ĤŠz¬—nàþÖΟñKÄöJé=ÌWèêT‹¸÷qÎჟ•q’zWUN«N/ØO^Ÿe|í¾©k{üõ4öV^ïù~G¹êzÂèº|·÷×[’Þ31†rpjg·n
Æ0Ý}kåË‹‰nîe¹ËÍ+™ÏVbrOç]'‰¼o®xÎh`¹Ç*±ÙÚ!T$d/$žN>¼WqᯅZ9ÑÒO\ÜÛê1o&,-z ~^NCgNÕéá)ÒÊ©7‰¨¯'Õþ¯þ_¿Ehîþóâ €ï¬uÛûý*ÎK9ä.â-öv<²‘×h$àãúW%ö¯~«g-ÕõÀàG~>Zú¾Iš+(šM³ Û#9äl%ðc¬ ûÝ xÖKG´x®|¸¤Ï™O:Ê8Ã’qÉcÔä‚yÇNJyËŒTj¥&µOmztjÿ ?KëaµÔù¯áýóXøãLeb¾tžAÇû`¨êGBAõ¾•:g˜’ù·,þhÀ`¬qÜ` e·~+å[±ý“âYÄjWì—µHé±ø?Nõô>½âX<5 Ç©ÏѼM¶8cܪXŽÉ^r?¼IróÈS•ZmÇ›™5»òÚÚ7ïu«&|·÷•Ά
>[©ÞXHeS$Œyà€ ÷ù²:ò2|óãDf? Z¼PD¶ÓßC(xÆ0|©ßR;ôMsÿ µ´ÔVi¬,͹›Ìxâi˜`¹,GAéÇlV§ÄýF×Yø§ê–‘:Ã=ò2³9n±ÉžØÏ@yÎWžæ±Ãàe„ÄÒN ]ïòêìú_Go'¦ŽÑ’_×õЯðR66þ!›ÑÄ gFMÙ— äžäqôÈ;ÿ eX<#%»Aö‰ãR¤ Í”Ž¹È G&¹Ÿƒ&á?¶Zˆ±keRè Kãnz·ãŠÕøÄÒÂ9j%@®×q±ÜŒý[õ-É$uíè&¤¶9zÇï·Oøï®ÄJKšÖìdü"µˆ[jײÎc;ã…B(g<9nàȯG½µŸPÓ.´Éfâ¼FŽP
31 ‘ÏR}<3šä~
Ã2xVöî Dr
Ç\›}Ý#S÷ÈÀëŽHÆI®à\OçKuäI¹†ó(”—GWî ñ³¹¸æ2¨›‹ºÚû%¾ýÖ_3ºNú¯ëúì|ÕÅÖ‰}ylM’ZËîTÿ á[ðÐñ/ˆ9Àû
¸ón3 Mòd‘÷ döª^.Êñް›BâîNp>cëÏçÍzïÃôÏ
YÍ%ª¬·ãÏ-*9ÜÂãhéŒc¾dÈêú¼Ë,. VŠ÷çeÿ n/¡¼äãõâ=‹xGQKx”|¹bÌŠD@2Œ 8'Ž àúƒŽ+áDÒ&¡¨"Œ§–Žr22 Ç·s]ŸÄ‹«ð%ÚÄ<¹ä’(×{e›HÀqÁç©Ç½`üŽÚõK饚9ƒÄ±€<–úƒú~ çðñO#Í%iKKlµ¦¾F)'Iê¬Î+Ç(`ñ¾£œdÈ’`™ºcßéé^ÿ i¸”Û\ý¡æhÔB«aq¸}ãÀÆ:ÜWƒ|FÛÿ BŒÇÀeaŸ-sÊ€:úW½ÜÝÜ<%$µ†%CóDªÀí%IÈÏʤ…ôäñÞŒ÷‘a0“ôŽÚë¤nŸoW÷0«e¶y'Å»aΗ2r’# Û°A^ý9ÉQÔõ=ù5¬£Öü.(Þ’M$~V«=éSÄFN½®©ÔWô»ÿ þHžkR‹ìÏ+µµžöê;khÚI¤m¨‹Ôš–âÖçJ¾_Z•’6a”Èô> ÕÉaÕ<%®£2n bQŠå\tÈõUÿ ø»þ‹k15‚ÃuCL$ݹp P1=Oøýs¯^u éEJ”–éêŸê½5ýzy›jÛ³á›Ûkÿ ÚOcn±ÛÏîW;boºz{ãžüVÆ¡a£a5½äÎÂks¸J@?1è¿{$ä‘=k”øsÖ^nŒ¦)ÝåXÃíùN1ØõÚOJë–xF÷h¸ Œ"Ž?x䜚ü³ì¨c*Fœ¯i;7~ñí׫Ðó¥Ë»3Ãü púw ‰°<Á%»ñž ÿ P+Û^ ¾Ye£ŽCÄŒ„/>˜>•á¶Ìm~&&À>M[hÈÈÿ [Ž•íd…RO@3^Ç(ʽ*¶ÖQZyßþ
1Vº}Ñç?¼O4Rh6R€ª£í¡ûÙ
a‚3ß·Õ
ü=mRÍ/µ9¤‚0ÑC¼Iè:cŽsÛ¾™x£ÆÐ¬ªÍöˢ샒W$•€Å{¨ÀPG
ÀÀàŸZìÍ1RÉ0´ðxEË9+Éÿ ^rEÕ—±Š„70l¼áË@û.' ¼¹Žz€N3úUÉ<3á×*?²¬‚ä†"Ùc=p íÛ'¡ª1ñ"økJ†HÒ'»Ÿ+
oÏN¬Ã9 dÙãÜדÏâÍ~æc+j·Jzâ7(£ðW]•æ™?nê´º6åwéåç÷N•ZŠíž›¬|?Ðõ?Ñ-E…®³ÇV$~X¯/…õ x‘LˆÑÜÚÈ7¦pzãÜüë½ðÄ^õtÝYËÍ7ÉÖÕ8ÏUe# #€r=sU¾/é’E§jRC4mxNÝ´9†íuá»›V‘
ZI€×cr1Ÿpzsøf»¨åV‹ìû`qËLÊIã?\~¼³áËC©êhªOîO»‘ÃmçÛçút×¢x“Z}?Üê#b-¤X7õÄò gž zzbº3œm*qvs·M=íúéw}¿&Úª°^Ö×µÏ(ø‡â†Öµƒenñý†×åQáYûœ÷ÇLœôÎNk¡ð‡¼/µ¸n0æÉ0¬ƒ‚üîÉÆvŒw®Sáö”š¯‹-üÕVŠØÙ[$`(9cqƒÔ_@BëqûÙ`Ýæ0;79È?w<ó |ÙÜkßÌ1±Ëã¿ìÒ»ðlìï«ÓnªèèrP´NÏš&ŽéöÙ¸÷æ°~-_O'‰`°!RÚÚÝ%]Ø%þbß1'¿ÿ XÕáOöÎŒ·‹¬+Åæ*ÛÛ™0¤ƒOÍÔ`u¯¦ÂaèÐÃÓ«‹¨Ô¥µœ¿¯ÉyÅÙ.oÔôŸ Úx&(STðݽ¦õ] ’ÒNóÁäÈùr3í·žÚ[™ƒ¼veÈ÷ÞIõÎGlqÎ=M|«gsªxÅI6
]Z·Îªä,¨zŒŽÄ~#ØŠúFñiÉqc©éÐD>S딑 GñŽ1éÐ^+
Ëi;Ô„µVÕú»i¯ÈÒ-ZÍ]òܘ®ì`bÛÙ¥_/y(@÷qÐúg Ô÷W0.Ø›
6Ò© r>QƒŒ0+Èîzb¨É+I0TbNñ"$~)ÕÒ6Þ‹{0VÆ27œWWñcÄcX×íôûyKZéðªc'iQ¿¯LaWŠŸS\·Š“źʸ…ôÙÂí|öÀÇåV|!¤ÂGâÛ[[’ï
3OrÙËPY¹=Î1õ5öåTžÑè Ú64/üö?Zëžk}¬¶éàoá¾á}3“ü]8Éæ¿´n²Žš_6¾pœ)2?úWÓÚ¥¾¨iWúdŽq{*ª1rXŒd…m»‰äcô¯–dâ•ã‘Jº¬§¨#¨®§,df«8ÉÅßN¾hˆ;îÓ=7áùpën®É 6ûJžO2^œÐò JÖø¥²ã›Ò6Ü·‰!wbÍ‚¬O©»õ¬ÿ ƒP=Ä:â¤-&ÙŽ
`È9 r9íϧzë> XÅ7ƒ5X–krÑ¢L7€ìw}ÑŸNHëŒüþ:2†á¼+u·á÷N/Û'Ðç~ߘô«ëh!ónRéeQ´6QÛÿ èEwëÅÒ|¸Yqó1uêyùzð8 ƒŠù¦Ò;¹ä6öi<'ü³„[ÃZhu½ ùÍ¡g‚>r¯×ŠîÌx}bñ2“k꣧oø~›hTèóËWò4|ki"xßQ˜Ï6øÀLnß‚0 ¹Æ{±–¶Öe#¨27È@^Ìß.1N¾œyç€õ†ñeé·Õã†çQ°€=Ì©ºB€Ø8<‚ÃSõ®ùcc>×Ú .Fr:žÝGæ=kÁâ,^!Fž
¬,àµ}%¶«îõ¹†"r²ƒGœüYÕd?aÑÃY®49PyU ÷þ!žxÅm|/‚ãNð˜¼PcûTÒ,¹/Ý=FkÏ|u¨¶«âë…{¤m¢]Û¾ïP>®XãÞ½iÓÁ¾
‰'¬–6ß¼(„ï— í!úÙäzôë^–:œ¨å|,_¿&š×]uÓѵÛô4’j”bž§x‘Æ©ã›á,‚[Ô
ÎÞ= ŒËæ ÀùYÁ?ŽïÚ¼?ÁªxºÕÛ,°1¸‘¿ÝäãØ¯v…@¤åq½ºã œàûââ·z8Xýˆþz~—û»™âµj=Ž
â~ãáh@'h¼F#·Üp?ŸëQü-løvépx»cŸø…lxâÃûG·‰¶ø”L£©%y?¦úõÆü-Õ¶¥y`Òl7>q’2üA?•F}c‡jB:¸Jÿ +§¹¿¸Q÷°ív=VÑìu[Qml%R7a×IèTõéŽx¬
?†š7
1†îã-ˆã’L¡lŽ0OÓ=ÅuˆpÇ•¼3ÛùÒ¶W/!|’wŽw^qÔ×ÏaóM8Q¨ãÑ?ëï0IEhÄa¸X•`a
?!ÐñùQ!Rä žqŽžÝO`I0ÿ J“y|ñ!Îã@99>þ8–+éáu…!ù—ä
ʰ<÷6’I®z
ÅS„¾)Zþ_Öýµ×ËPåOwø÷þ*üïænÖùmØÝûþ¹=>¦½öî×Jh]¼ç&@§nTŒ6ITÀõ^Fxð7Å3!Ö·aÛ$þÿ ¹ã5îIo:ȪmËY[’8ÇӾlj*òû¢¥xõ¾¼ú•åk+\ð¯ HÚoŽl•Ûk,¯ ç²²cõÅ{²Z\
´ìQ åpzŽ3Ôð}ÿ Jð¯XO¡øÎé€hÙ¥ûLdŒ`““ù6Gá^ÃáÝ^Ë[Ñb¾YåŒÊ»dŽ4†2§,;ÿ CQÄ´¾°¨c–±”mºV{«ßÕýÄW\ÖŸ‘çŸ,çMRÆí“l-ƒn~ë©ÉÈê Ü?#Ž•¹ðãSÒ¥ÐWNíà½;ãž)™ÎSÈ9cóLj뵿ūiÍk¨ió¶X‚7÷ƒ€yãnyÏŽëÞ Öt`×À×V's$È9Ú:ä{wÆEk€«†Çàc—â$éÎ.éí~Ýëk}ÅAÆpörÑ¢‡Šl¡ÑüSs‹¨‰IÄóÀ×wñ&eºðf™pŒÆ9gŽTø£lñëÀçŽ NkÊUK0U’p ï^¡ãÈ¥´ø{£ÙHp`’ØåbqÏ©äó^Æ:
Ž' ÊóM«õz+ß×ó5Ÿ»('¹ð¦C„$˜Å¢_ºÈI?»^äã'ñêzž+ë€ñ-½»´}¡Ë*õ?.xÇ^1ŽMyǸ&“—L–îëöâ7…' bqéÎGé]˪â1$o²¸R8Ã`.q€}sÖ¾C98cêÆÞíïóòvÓòùœÕfÔÚéýuèÖ·Ú
Å‚_¤³ÜۺƑß”àרý:׃xPþÅÕî-/üØmnQìïGΊÙRqê=>¢½õnæ·r!—h`+’;ò3È<“Û©éšóŸx*÷V¹¸×tÈiˆßwiÔÿ |cŒñÏ®3ֽ̰‰Ë Qr©ö½®¼ÛoÑÙZÅÑ«O൯ýw8;k›ÿ x†;ˆJa;‘º9÷÷R+¡ñgŽí|Iáë{ôáo2ʲ9 029ÉÏLí\‰¿¸Ÿb˜ "Bv$£ßiê>=ªª©f
’N ëí>¡NXW~5×úíø\‰»½Ï^ø(—wÖú¥¤2íŽÞXæÁ$°eÈ888^nÝë²ñÝÔ^ ÖÚ9Q~Ëå7ï
DC¶ÑµƒsËÇè9®Wáþƒ6‡£´·°2\Ý:ÈÑ?(#¨'$õèGJ¥ñW\ÿ ‰E¶—¸™g˜ÌÀ¹;Pv ú±ÎNs·ëŸ’–"Ž/:té+ûË]öJöÓM»ëø˜*‘•^Uý—êd|‰åñMæÔÝ‹23å™6æHùÛ‚ëüñ^…ñ1¢oêûÑEØ.õ7*ÅHtÎp{g<·Á«+¸c¿¿pÓ¾Æby=8É_ÄsÆk¬ñB\jÞÔì••Ë[9Píb‹Bヅ =93§ð§LšÛáÖšÆæXÌÞdÛP.0\ãïÛ0?™úJ¸™Ë
”•œº+=<µI£¦í¯õêt¬d‹T¬P=ËFêT>ÍØØ@Ï9<÷AQÌ×»Õ¡xùk",JÎæù±Éç$œŽŸZWH®¯"·UÌQ ’ÙÈ]ÅXg<ã
ߨg3-Üqe€0¢¨*Œ$܃
’Sû 8㎼_/e'+Ï–-èÓ¶¶Õíß[·ÙÙ½îì—¼sk%§µxä‰â-pÒeÆCrú
ôσžû=”šÅô(QW‚Õd\ƒæ. \àö¹¯F½°³½0M>‘gr÷q+œ¶NïºHO— ¤ ܥݔn·J|ÆP6Kµc=Isó}Ò çGš)a=—#vK›åoK§ßóÙ¤¶¿õú…ÄRÚ[ËsöÙ¼Ë•Ë ópw®qœŒ·Ø
ùÇâ‹ý‡ãKèS&ÞvûDAù‘É9ŒîqÅ}
$SnIV[]Ñ´Ó}ØÜ¾A Ü|½kÅþÓ|EMuR¼.I¼¶däò‚ÃkÆ}ðy¹vciUœZ…Õõ»z¾÷¿n¦*j-É/àœHã\y5 Û ß™ó0—äŸnzôã#Ô¯,†¥ÚeÔ÷ÜÅ´„“'c…<íÝ€<·SŠ¥k§Ã¢éÆÆÙna‚8–=«Êª[Ÿ™°pNî02z“ÔÙ–K8.È’Þî(vƒ2®@ äÈûãçžxäÇf¯ˆu¹yUÕîýWšÙ|›ëÒ%Q^í[æ|éo5ZY•^{96ˆY‚§v*x>âº_|U¹Ö´©tûMÒÂ9PÇ#«£#€ éÉñ‘ƒÍz/‰´-į¹°dd,Б›p03ƒœ{ç9=+
Ûᧇ¬¦[‡‚ê婺¸#±ß=³ý¿•Õµjñ½HÙh›Û[§ÚýÊöô÷{˜?ô÷·Ô.u©–_%còcAÀ˜’
}0x9Î>žñÇáÍ9,ahï¦Ì2òÓ ñÛAäry$V²Nð
]=$Ž
‚#Ù‚1ƒƒødõMax‡ÂÖ^!±KkÛ‘
«“Çó²FN8+ëÎ{Ò¼oí§[«ÕMRoËeç×[_m/¦¦k.kôgŽxsSÓ´ý`êzªÜÜKo‰cPC9ÎY‰#§^üý9¹âïÞx£Ë·Ú`±‰‹¤;³–=ÏaôÕAð‚÷kêÁNBéÎælcõö®£Fð†ô2Ò¬]ßÂK$ÓÜ®•”/ÊHàã$ä¸÷ëf¹Oµúâ“”’²øè´µþöjçNü÷üÌ¿ xNïFÒd»¼·h®îT9ŽAµÖ>qÁçÔœtïÒ»\ȶÎîcÞäîó3¶@#ÉIÎ ÔñW.<´’¥–ÑÑ€ÕšA‚ ;†qÓë‚2q
ÒÂó$# Çí‡
!Ë}Õ9ÈÎÑÉã=;ŒÇÎuñ+ÉûÏ¥öíeÙ+$úíÜ娯'+êZH4ƒq¶FV‹gïŒ208ÆÌ)íб>M|÷âÍã¾"iì‹¥£Jd´™OÝç;sÈúr+ÜäˆË)DŒ¥šF°*3Õ”d{zÔwºQ¿·UžÉf†~>I+ŒqÔ`ð3œ“Ü×f]œTÁÔn4“ƒø’Ýßõ_«*5šzGCÊ,þ+ê1ò÷O¶¸cœºb2yÇ;cùÕ£ñh¬›áÑŠr¤ÝäNBk¥—á—†gxšX/쑘hŸ*Tçn =ûã¦2|(ð¿e·ºÖ$
ýìŸ!'åΰyîî+×öœ=Y:²¦ÓÞ×iü’—ü
-BK™£˜›âÆ¡&véðõ-ûÉY¹=Onj¹ø¯¯yf4·±T Pó`çœ7={×mÃ/¢˜ZÚòK…G½¥b„’G AãÜœ*í¯Ã¿ IoæI¦NU8‘RwÈã;·€ Û×ëÒ”1Y
•£E»ÿ Oyto¢<£Áö·šï,䉧ûA¼sû»Nò}¹üE{ÜÖªò1’õÞr0â}ÎØ#>à/8ïéÎ~—áÍ#ñÎlí§³2f'h”?C÷YËdð:qëõÓ·‚ïeÄ©
ÔÈØÜRL+žAÎ3¼g=åšó³Œt3
ÑQ¦ùRÙßE®¼±w_;þhš’Sirÿ ^ˆã¼iੇ|RòO„m°J/“$·l“ ÇÓ¿ÿ [ÑŠÆ“„†Õø>cFÆ6Ø1ƒ– àz7Ldòxäüwá‹ÝAXùO•Úý’é®ähm •NÀ±ÌTÈç
ƒ‘I$pGž:‚ÄbêW¢®œ´|¦nÍ>¶ÖÏ¢§ÎÜ¢ºö¹•%ÄqL^öÛKpNA<ã¡ …î==ª¸óffËF‡yÌcÉ ©ç$ð=ñÏYþÊ’Ú]—¥‚¬‚eDïÎH>Ÿ_ÌTP™a‰ch['çÆÜò7a‡?w°Ïn§âÎ5”’¨¹uÚÛ|´ÓÓc§{O—ü1•ªxsÃZ…ÊÏy¡Ã3¸Ë2Èé» ‘ƒÎ äžÜðA§cáOéúÛ4ý5-fŒï„ù¬ûô.Ç Üsž•Ò¾•wo<¶Ÿ"¬¡º|£
î2sÇ¡éE²ÉFѱrU°dÜ6œ¨ mc†Îxë׺Þ'0²¡Rr„{j¾í·è›µ÷)º·å–‹î2|I®Y¼ºÍË·–ÃÆàã£'óÆxƒOÆÞ&>\lóÌxP Xc¸ì Sþ5§qà/ê>#žÞW¸if$\3 ® ûÄ“ùŽÕê¾ð<Ó‹H¶óÏ" å·( á‘€:ã†8Ï=+ꨬUA×ÃËÚT’ÑÞöù¥¢]{»ms¥F0\ÑÕ—ô}&ÛB´ƒOŽÚ+›xíÄÀ1
,v± žIëíZ0ǧ™3í2®0ทp9öÝÔž)ÓZËoq/Ú“‘L ²ŒmùŽï‘Ó9§[Û#Ä‘\ÞB¬Çs [;à à«g‚2ôòªœÝV§»·¯/[uó½õÛï¾
/šÍ}öüÿ «=x»HŸÂÞ.™ ÌQùŸh´‘#a$‚'¡u<Š›Æ>2>+ƒLSiöwµFó1!eg`£åœ ÷ëÛö}Á¿ÛVÙêv $¬ƒ|,s÷z€ð΃¨x÷ÅD\ÜŒÞmåÔ„ ˆ o| :{ÇÓ¶–òÁn!´0Ål€, ƒ ( ÛŒŒc¶rsšæ,4‹MÛOH!@¢ ÇŽ„`å²9ÝÃw;AÍt0®¤¡…¯ØÄ.Àìí´ƒ‘ßñ5Í,Óëu-ÈÔc¢KÃÓ£òÖ̺U.õL¯0…%2È—"~x
‚[`có±nHàŽyàö™¥keˆìŒÛFç{(Ø©†`Jã#Žwg<“:ÚÉ;M
^\yhûX‡vB·÷zrF?§BÊÔ/s<ÐÈB)Û± ·ÍÔwç5Âã:så§e{mѤï«Òíh—]Wm4âí¿ùþW4bC3¶ª¾Ùr$pw`àädzt!yŠI„hÂîàM)!edŒm'æ>Ç?wzºKìcŒ´¯Ìq6fp$)ãw¡éUl`µ»ARAˆÝÕgr:äŒgƒéé[Ôö±”iYs5Ýï«ÙG—K=þF’æMG«óÿ `ŠKɦuOQ!ÕåŒ/ÎGÞ`@ËqÕzdõâ«Ê/Ö(ƒK´%ŽbMüåÜŸö—>¤óŒŒV‘°„I¢Yž#™¥ùÏÊ@8
œgqöö5ª4vד[¬(q cò¨À!FGaÁõõ¯?§†¥ÏU½í¿WªZ$úyú½Žz×§Éþ?>Ã×È•6°{™™ŽÙ.$`ÎUœ…çè ' ¤r$1Ø(y7 ðV<ž:È ÁÎMw¾Â'Øb§øxb7gãО½óÉÊë²,i„Fȹ£§8ãä½k¹¥¦ê/ç{ïê驪2œ/«ü?¯Ô›ìñÜ$þeýœRIåŒg9Ác’zrrNO bÚi¢
ѺË/$,“ª¯Ýä;Œ× ´<ÛÑn³IvŸb™¥ nm–ÄŸ—nÝÀãŽ3ëÍG,.öó³˜Ù£¹uÊÌrŠ[<±!@Æ:c9ÅZh
ì’M5ÄìÌ-‚¼ëÉùqŽGì9¬á ;¨A-ž—évþÖ–^ON·Ô”ŸEý}ú×PO&e[]ÒG¸˜Ûp ƒÃà/Ë·8ûÀ€1ž@¿ÚB*²¼ñì8@p™8Q“žÆH'8«I-%¸‚
F»“åó6°Uù|¶Ú¸ã ò^Äw¥ŠÖK–1ÜÝK,Žddlí²0PÀü“×ükG…¯U«·¶–´w¶ŽÍ¾©yÞú[Zös•¯Á[™6°
¨¼ÉVæq·,#
ìãï‘×8îry®A››¨,ãc66»Ë´ã'æÉù?t}¢æH--Òá"›|ˆ¬[í 7¶ö#¸9«––‹$,+Ëqœ\Êøc€yê^ݸÄa°«™B-9%«×®‹V´w~vÜTéꢷþ¼ˆ%·¹• ’[xç•÷2gØS?6åÀÚ õ9É#š@÷bT¸º²C*3Bá¤òÎA9 =úU§Ó"2Ãlá0iÝIc‚2Î@%öç94ùô»'»HÄ¥Ô¾@à Tp£šíx:úÊ:5eºßMý×wµ›Ó_+šº3Ýyvÿ "ºÇ<ÂI>Õ1G·Ë«È«É# àÈÇ øp Jv·šæDûE¿›†Ë’NFr2qŸ½ÇAÜšu•´éí#Ħ8£2”Ú2Ã/€[ÎTr;qŠz*ý’Îþ(≠;¡TÆâ›;ºÿ àçœk‘Þ8¾Uª¾íé{^×IZéwÓkXÉûÑZo¯_øo×È¡¬ â–ÞR§2„‚Àœü½ùç® SVa†Âüª¼±D‘ŒísŸàä|ä2 æ[‹z”¯s{wn„ÆmáóCO+†GO8Ïeçåº`¯^¼ðG5f{Xžä,k‰<á y™¥voÆ éÛõëI=œ1‹éíÔÀÑ)R#;AÂncäŽ:tÏ#¶TkB.0Œ-ÖÞZÛgumß}fÎJÉ+#2êÔP£žùÈÅi¢%œ3P*Yƒò‚A쓎2r:ƒÐúñiRUQq‰H9!”={~¼“JŽV¥»×²m.ÛߺiYl¾òk˜gL³·rT•
’…wHÁ6ä`–Î3ùÌ4Øe³†&òL‘•%clyîAÂäà0 žüç$[3uŘpNOÀÉ=† cï{rYK
ååä~FÁ
•a»"Lär1Ó¯2Äõæ<™C•.fÕ»è¥~½-¿g½Â4¡{[ør¨¶·Žõäx¥’l®qpwÇ»8ärF \cޏܯÓ-g‚yciÏÀ¾rÎwèØÈ#o°Á9ã5¢šfÔxÞæfGusÏÌJÿ µ×œ/LtãÅT7²¶w,l
ɳ;”eúà·¨çîŒsÜgTÃS¦^ '~‹®›¯+k÷ZÖd©Æ*Ó[Ü«%Œk0ŽXƒ”$k#Ȩ P2bv‘ƒŸáÇ™ÆÕb)m$É*8óLE‘8'–ÜN Úyàúô+{uº±I'wvš4fÜr íì½=úuú
sFlìV$‘ö†HÑù€$§ õ=½¸«Ž]
:Ž+•¦ïmRþ½l´îÊT#nkiøÿ _ðÆT¶7Ò½ºÒ£Î¸d\ã8=yãŽÜäR{x]ZâÚé#¸r²#»ÎHÆ6õ ç® ÎFkr;sºÄ.&;só±Ç9êH÷ýSšÕtÐU¢-n Ì| vqœ„{gŒt§S.P‹’މ_[;m¥ÞZýRûÂX{+¥úü¼ú•-àÓ7!„G"“´‹žƒnrYXã¸îp éœ!ÓoPÌtÑ (‰Þ¹é€sÓ#GLçÕšÑnJý¡!‘Tä#“ß?îýp}xÇ‚I¥Õn#·¸–y'qó@r[ Êô÷<ÔWÃÓ¢áN¥4Ô’I&ݼ¬¬¼ÞºvéÆ
FQV~_ÒüJÖÚt¥¦Xá3BÄP^%ÈÎW-×c¡ú©¤·Iþèk¥š?–UQåIR[’O 5x\ÉhÆI¶K4«2ùªŠŒ<¼óœçØ`u«‚Í.VHä€ Ëgfx''9ÆI#±®Z8
sISºku¢ßÞ]úk»Jößl¡B.Ü»ÿ MWe
°·Ž%šêɆ¼»Âù³´œ O¿cÐÓÄh©"ÛÜÏ.ÖV’3nüÄmnq[ŒòznšÖ>J¬òˆæ…qýØP Ž:ä7^0yëWšÍ_79äoaÈ °#q0{ää×mœy”R{vÒÞ¶ÚÏe¥“ÚÆÐ¥Ì®—õýjR •íç›Ìb„+JyÜØÙ•Ç]¿Ôd þËOL²”9-Œ—õÃc'æÝלçÚ²ìejP“½
âù°¨†ðqòädЃÉäÖÜj÷PÇp“ÍšŠå«‘î
<iWNsmª»¶vÓz5»ûì:Rs\Ðßôû×uÔÿÙ